About 4-aminoheptan-3-one;ethane
4-aminoheptan-3-one;ethane (PubChem CID 143359235) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is 4-aminoheptan-3-one;ethane.
Molecular Properties
| Compound Name | 4-aminoheptan-3-one;ethane |
| PubChem CID | 143359235 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 4-aminoheptan-3-one;ethane |
| SMILES | CC.CCCC(N)C(=O)CC |
| InChI | InChI=1S/C7H15NO.C2H6/c1-3-5-6(8)7(9)4-2;1-2/h6H,3-5,8H2,1-2H3;1-2H3 |
| InChIKey | IYYNYMHOVBSBLX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminoheptan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoheptan-3-one;ethane?
The IUPAC name of 4-aminoheptan-3-one;ethane (CID 143359235) is 4-aminoheptan-3-one;ethane.
What is the SMILES notation for 4-aminoheptan-3-one;ethane?
The canonical SMILES for 4-aminoheptan-3-one;ethane is CC.CCCC(N)C(=O)CC.
What is the InChIKey of 4-aminoheptan-3-one;ethane?
The InChIKey is IYYNYMHOVBSBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H6/c1-3-5-6(8)7(9)4-2;1-2/h6H,3-5,8H2,1-2H3;1-2H3.
What are the key properties of 4-aminoheptan-3-one;ethane?
4-aminoheptan-3-one;ethane has a molecular weight of 159.27 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoheptan-3-one;ethane is sourced from PubChem (CID 143359235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).