About (2S)-1,2-diaminopentan-3-one
(2S)-1,2-diaminopentan-3-one (PubChem CID 88560983) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is (2S)-1,2-diaminopentan-3-one.
Molecular Properties
| Compound Name | (2S)-1,2-diaminopentan-3-one |
| PubChem CID | 88560983 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (2S)-1,2-diaminopentan-3-one |
| SMILES | CCC(=O)[C@@H](N)CN |
| InChI | InChI=1S/C5H12N2O/c1-2-5(8)4(7)3-6/h4H,2-3,6-7H2,1H3/t4-/m0/s1 |
| InChIKey | INAPOURPCSTLAV-BYPYZUCNSA-N |
| XLogP | -0.75 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1,2-diaminopentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-diaminopentan-3-one?
The IUPAC name of (2S)-1,2-diaminopentan-3-one (CID 88560983) is (2S)-1,2-diaminopentan-3-one.
What is the SMILES notation for (2S)-1,2-diaminopentan-3-one?
The canonical SMILES for (2S)-1,2-diaminopentan-3-one is CCC(=O)[C@@H](N)CN.
What is the InChIKey of (2S)-1,2-diaminopentan-3-one?
The InChIKey is INAPOURPCSTLAV-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H12N2O/c1-2-5(8)4(7)3-6/h4H,2-3,6-7H2,1H3/t4-/m0/s1.
What are the key properties of (2S)-1,2-diaminopentan-3-one?
(2S)-1,2-diaminopentan-3-one has a molecular weight of 116.16 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-diaminopentan-3-one is sourced from PubChem (CID 88560983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).