C14H30N2O — CID 94859791
(2S)-1,2-diaminotetradecan-3-one (PubChem CID 94859791) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is (2S)-1,2-diaminotetradecan-3-one.
| Compound Name | (2S)-1,2-diaminotetradecan-3-one |
|---|---|
| PubChem CID | 94859791 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | (2S)-1,2-diaminotetradecan-3-one |
| SMILES | CCCCCCCCCCCC(=O)[C@@H](N)CN |
| InChI | InChI=1S/C14H30N2O/c1-2-3-4-5-6-7-8-9-10-11-14(17)13(16)12-15/h13H,2-12,15-16H2,1H3/t13-/m0/s1 |
| InChIKey | JESAYQYBBWNZRF-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|