C24H47N2Na3O7 — CID 173291245
trisodium;1,2-diaminooctadecan-3-one;triacetate (PubChem CID 173291245) has the molecular formula C24H47N2Na3O7 and a molecular weight of 544.62 g/mol. Its IUPAC name is trisodium;1,2-diaminooctadecan-3-one;triacetate.
| Compound Name | trisodium;1,2-diaminooctadecan-3-one;triacetate |
|---|---|
| PubChem CID | 173291245 |
| Molecular Formula | C24H47N2Na3O7 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | trisodium;1,2-diaminooctadecan-3-one;triacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CCCCCCCCCCCCCCCC(=O)C(N)CN.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C18H38N2O.3C2H4O2.3Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(20)16-19;3*1-2(3)4;;;/h17H,2-16,19-20H2,1H3;3*1H3,(H,3,4);;;/q;;;;3*+1/p-3 |
| InChIKey | QHCAURAWCMXTKW-UHFFFAOYSA-K |
| XLogP | -8.40 |
| TPSA | 189.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | -8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|