C7H16N2O — CID 157131527
(2S)-1,2-diaminoheptan-3-one (PubChem CID 157131527) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is (2S)-1,2-diaminoheptan-3-one.
| Compound Name | (2S)-1,2-diaminoheptan-3-one |
|---|---|
| PubChem CID | 157131527 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (2S)-1,2-diaminoheptan-3-one |
| SMILES | CCCCC(=O)[C@@H](N)CN |
| InChI | InChI=1S/C7H16N2O/c1-2-3-4-7(10)6(9)5-8/h6H,2-5,8-9H2,1H3/t6-/m0/s1 |
| InChIKey | TWRNLJWQJAMASR-LURJTMIESA-N |
| XLogP | 0.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |