About 4-aminododec-1-yn-5-one
4-aminododec-1-yn-5-one (PubChem CID 116606528) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-aminododec-1-yn-5-one.
Molecular Properties
| Compound Name | 4-aminododec-1-yn-5-one |
| PubChem CID | 116606528 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-aminododec-1-yn-5-one |
| SMILES | C#CCC(N)C(=O)CCCCCCC |
| InChI | InChI=1S/C12H21NO/c1-3-5-6-7-8-10-12(14)11(13)9-4-2/h2,11H,3,5-10,13H2,1H3 |
| InChIKey | RMRBURCWSHJCBF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminododec-1-yn-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminododec-1-yn-5-one?
The IUPAC name of 4-aminododec-1-yn-5-one (CID 116606528) is 4-aminododec-1-yn-5-one.
What is the SMILES notation for 4-aminododec-1-yn-5-one?
The canonical SMILES for 4-aminododec-1-yn-5-one is C#CCC(N)C(=O)CCCCCCC.
What is the InChIKey of 4-aminododec-1-yn-5-one?
The InChIKey is RMRBURCWSHJCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-3-5-6-7-8-10-12(14)11(13)9-4-2/h2,11H,3,5-10,13H2,1H3.
What are the key properties of 4-aminododec-1-yn-5-one?
4-aminododec-1-yn-5-one has a molecular weight of 195.31 g/mol, XLogP of 2.27, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminododec-1-yn-5-one is sourced from PubChem (CID 116606528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).