C8H19N3O — CID 163702186
3,4-diamino-1-(butan-2-ylamino)butan-2-one (PubChem CID 163702186) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,4-diamino-1-(butan-2-ylamino)butan-2-one.
| Compound Name | 3,4-diamino-1-(butan-2-ylamino)butan-2-one |
|---|---|
| PubChem CID | 163702186 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 3,4-diamino-1-(butan-2-ylamino)butan-2-one |
| SMILES | CCC(C)NCC(=O)C(N)CN |
| InChI | InChI=1S/C8H19N3O/c1-3-6(2)11-5-8(12)7(10)4-9/h6-7,11H,3-5,9-10H2,1-2H3 |
| InChIKey | KBYZSCRDVYYSRR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |