C9H21N3O — CID 22841856
(3R)-3,4-diamino-1-(1-deuteriopentylamino)butan-2-one (PubChem CID 22841856) has the molecular formula C9H21N3O and a molecular weight of 188.29 g/mol. Its IUPAC name is (3R)-3,4-diamino-1-(1-deuteriopentylamino)butan-2-one.
| Compound Name | (3R)-3,4-diamino-1-(1-deuteriopentylamino)butan-2-one |
|---|---|
| PubChem CID | 22841856 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | (3R)-3,4-diamino-1-(1-deuteriopentylamino)butan-2-one |
| SMILES | [2H]C(CCCC)NCC(=O)[C@H](N)CN |
| InChI | InChI=1S/C9H21N3O/c1-2-3-4-5-12-7-9(13)8(11)6-10/h8,12H,2-7,10-11H2,1H3/t8-/m1/s1/i5D/t5?,8- |
| InChIKey | KDRLRHSSCMJHTL-FPLGDQBJSA-N |
| XLogP | -0.38 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |