About aluminum;2-methylpentan-3-one;triiodide
aluminum;2-methylpentan-3-one;triiodide (PubChem CID 163663533) has the molecular formula C6H12AlI3O
and a molecular weight of 507.86 g/mol. Its IUPAC name is aluminum;2-methylpentan-3-one;triiodide.
Molecular Properties
| Compound Name | aluminum;2-methylpentan-3-one;triiodide |
| PubChem CID | 163663533 |
| Molecular Formula | C6H12AlI3O |
| Molecular Weight | 507.86 g/mol |
| Exact Mass | 507.78 |
| IUPAC Name | aluminum;2-methylpentan-3-one;triiodide |
| SMILES | CCC(=O)C(C)C.[Al+3].[I-].[I-].[I-] |
| InChI | InChI=1S/C6H12O.Al.3HI/c1-4-6(7)5(2)3;;;;/h5H,4H2,1-3H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | IWKHMGZYBXGNFW-UHFFFAOYSA-K |
| XLogP | -7.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.86 |
| LogP ≤ 5 | -7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze aluminum;2-methylpentan-3-one;triiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;2-methylpentan-3-one;triiodide?
The IUPAC name of aluminum;2-methylpentan-3-one;triiodide (CID 163663533) is aluminum;2-methylpentan-3-one;triiodide.
What is the SMILES notation for aluminum;2-methylpentan-3-one;triiodide?
The canonical SMILES for aluminum;2-methylpentan-3-one;triiodide is CCC(=O)C(C)C.[Al+3].[I-].[I-].[I-].
What is the InChIKey of aluminum;2-methylpentan-3-one;triiodide?
The InChIKey is IWKHMGZYBXGNFW-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H12O.Al.3HI/c1-4-6(7)5(2)3;;;;/h5H,4H2,1-3H3;;3*1H/q;+3;;;/p-3.
What are the key properties of aluminum;2-methylpentan-3-one;triiodide?
aluminum;2-methylpentan-3-one;triiodide has a molecular weight of 507.86 g/mol, XLogP of -7.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;2-methylpentan-3-one;triiodide is sourced from PubChem (CID 163663533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).