C6H12O — CID 101215881
1,1,1-trideuterio-2-methylpentan-3-one (PubChem CID 101215881) has the molecular formula C6H12O and a molecular weight of 103.18 g/mol. Its IUPAC name is 1,1,1-trideuterio-2-methylpentan-3-one.
| Compound Name | 1,1,1-trideuterio-2-methylpentan-3-one |
|---|---|
| PubChem CID | 101215881 |
| Molecular Formula | C6H12O |
| Molecular Weight | 103.18 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | 1,1,1-trideuterio-2-methylpentan-3-one |
| SMILES | [2H]C([2H])([2H])C(C)C(=O)CC |
| InChI | InChI=1S/C6H12O/c1-4-6(7)5(2)3/h5H,4H2,1-3H3/i2D3 |
| InChIKey | HYTRYEXINDDXJK-BMSJAHLVSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |