About Butyldioxy, 1-methyl-2-oxo-
Butyldioxy, 1-methyl-2-oxo- (PubChem CID 100939807) has the molecular formula C5H9O3
and a molecular weight of 117.12 g/mol.
Molecular Properties
| Compound Name | Butyldioxy, 1-methyl-2-oxo- |
| PubChem CID | 100939807 |
| Molecular Formula | C5H9O3 |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | — |
| SMILES | CCC(=O)C(C)O[O] |
| InChI | InChI=1S/C5H9O3/c1-3-5(6)4(2)8-7/h4H,3H2,1-2H3 |
| InChIKey | CDSGESVUTOFJGL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze Butyldioxy, 1-methyl-2-oxo- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butyldioxy, 1-methyl-2-oxo-?
The IUPAC name of Butyldioxy, 1-methyl-2-oxo- (CID 100939807) is not available.
What is the SMILES notation for Butyldioxy, 1-methyl-2-oxo-?
The canonical SMILES for Butyldioxy, 1-methyl-2-oxo- is CCC(=O)C(C)O[O].
What is the InChIKey of Butyldioxy, 1-methyl-2-oxo-?
The InChIKey is CDSGESVUTOFJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O3/c1-3-5(6)4(2)8-7/h4H,3H2,1-2H3.
What are the key properties of Butyldioxy, 1-methyl-2-oxo-?
Butyldioxy, 1-methyl-2-oxo- has a molecular weight of 117.12 g/mol, XLogP of 0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Butyldioxy, 1-methyl-2-oxo- is sourced from PubChem (CID 100939807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).