C10H20O — CID 123222791
4,5,6-trimethylheptan-3-one (PubChem CID 123222791) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is 4,5,6-trimethylheptan-3-one.
| Compound Name | 4,5,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 123222791 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 4,5,6-trimethylheptan-3-one |
| SMILES | CCC(=O)C(C)C(C)C(C)C |
| InChI | InChI=1S/C10H20O/c1-6-10(11)9(5)8(4)7(2)3/h7-9H,6H2,1-5H3 |
| InChIKey | MOLHPXIPYJJBFV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |