C9H18O2 — CID 79416996
6-methoxy-4,5-dimethylhexan-3-one (PubChem CID 79416996) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 6-methoxy-4,5-dimethylhexan-3-one.
| Compound Name | 6-methoxy-4,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 79416996 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 6-methoxy-4,5-dimethylhexan-3-one |
| SMILES | CCC(=O)C(C)C(C)COC |
| InChI | InChI=1S/C9H18O2/c1-5-9(10)8(3)7(2)6-11-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | SCDZBPAPMDNDLN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |