C13H28O2Si — CID 102183052
(4S,5R,6S)-4,6-dimethyl-5-trimethylsilyloxyoctan-3-one (PubChem CID 102183052) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (4S,5R,6S)-4,6-dimethyl-5-trimethylsilyloxyoctan-3-one.
| Compound Name | (4S,5R,6S)-4,6-dimethyl-5-trimethylsilyloxyoctan-3-one |
|---|---|
| PubChem CID | 102183052 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (4S,5R,6S)-4,6-dimethyl-5-trimethylsilyloxyoctan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C13H28O2Si/c1-8-10(3)13(15-16(5,6)7)11(4)12(14)9-2/h10-11,13H,8-9H2,1-7H3/t10-,11+,13+/m0/s1 |
| InChIKey | KNLPQXJZOLNONQ-DMDPSCGWSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|