C7H14O3 — CID 13262413
methyl (2R,3R)-2-hydroxy-3-methylpentanoate (PubChem CID 13262413) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is methyl (2R,3R)-2-hydroxy-3-methylpentanoate.
| Compound Name | methyl (2R,3R)-2-hydroxy-3-methylpentanoate |
|---|---|
| PubChem CID | 13262413 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | methyl (2R,3R)-2-hydroxy-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C7H14O3/c1-4-5(2)6(8)7(9)10-3/h5-6,8H,4H2,1-3H3/t5-,6-/m1/s1 |
| InChIKey | OQXGUAUSWWFHOM-PHDIDXHHSA-N |
| XLogP | 0.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |