C6H13O4P — CID 89354367
4,5-dihydroxy-6-phosphanyloxyhexan-3-one (PubChem CID 89354367) has the molecular formula C6H13O4P and a molecular weight of 180.14 g/mol. Its IUPAC name is 4,5-dihydroxy-6-phosphanyloxyhexan-3-one.
| Compound Name | 4,5-dihydroxy-6-phosphanyloxyhexan-3-one |
|---|---|
| PubChem CID | 89354367 |
| Molecular Formula | C6H13O4P |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 4,5-dihydroxy-6-phosphanyloxyhexan-3-one |
| SMILES | CCC(=O)C(O)C(O)COP |
| InChI | InChI=1S/C6H13O4P/c1-2-4(7)6(9)5(8)3-10-11/h5-6,8-9H,2-3,11H2,1H3 |
| InChIKey | FIKIDVDYDYVTIJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|