C6H12O4 — CID 126497812
3,4-dihydroxy-5-methoxypentan-2-one (PubChem CID 126497812) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 3,4-dihydroxy-5-methoxypentan-2-one.
| Compound Name | 3,4-dihydroxy-5-methoxypentan-2-one |
|---|---|
| PubChem CID | 126497812 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 3,4-dihydroxy-5-methoxypentan-2-one |
| SMILES | COCC(O)C(O)C(C)=O |
| InChI | InChI=1S/C6H12O4/c1-4(7)6(9)5(8)3-10-2/h5-6,8-9H,3H2,1-2H3 |
| InChIKey | FGAIKIFGZKULHH-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |