C4H12N2O2 — CID 126732231
1,1-diamino-3-methoxypropan-2-ol (PubChem CID 126732231) has the molecular formula C4H12N2O2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 1,1-diamino-3-methoxypropan-2-ol.
| Compound Name | 1,1-diamino-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 126732231 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 1,1-diamino-3-methoxypropan-2-ol |
| SMILES | COCC(O)C(N)N |
| InChI | InChI=1S/C4H12N2O2/c1-8-2-3(7)4(5)6/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | BPZMSUWVEQTBTJ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|