C6H14O4 — CID 174089991
(4R)-1-methoxypentane-2,3,4-triol (PubChem CID 174089991) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is (4R)-1-methoxypentane-2,3,4-triol.
| Compound Name | (4R)-1-methoxypentane-2,3,4-triol |
|---|---|
| PubChem CID | 174089991 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (4R)-1-methoxypentane-2,3,4-triol |
| SMILES | COCC(O)C(O)[C@@H](C)O |
| InChI | InChI=1S/C6H14O4/c1-4(7)6(9)5(8)3-10-2/h4-9H,3H2,1-2H3/t4-,5?,6?/m1/s1 |
| InChIKey | XRNVOOAAWLYRMJ-IISSFJTQSA-N |
| XLogP | -1.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |