C8H17NO5 — CID 54235529
(2S,4R,5R)-2-amino-1,5-dihydroxy-4,6-dimethoxyhexan-3-one (PubChem CID 54235529) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2S,4R,5R)-2-amino-1,5-dihydroxy-4,6-dimethoxyhexan-3-one.
| Compound Name | (2S,4R,5R)-2-amino-1,5-dihydroxy-4,6-dimethoxyhexan-3-one |
|---|---|
| PubChem CID | 54235529 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2S,4R,5R)-2-amino-1,5-dihydroxy-4,6-dimethoxyhexan-3-one |
| SMILES | COC[C@@H](O)[C@@H](OC)C(=O)[C@@H](N)CO |
| InChI | InChI=1S/C8H17NO5/c1-13-4-6(11)8(14-2)7(12)5(9)3-10/h5-6,8,10-11H,3-4,9H2,1-2H3/t5-,6+,8+/m0/s1 |
| InChIKey | QMHNKCCWTWBOSS-SHYZEUOFSA-N |
| XLogP | -2.10 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |