C6H16N2O2 — CID 11051828
(2S,3S)-1,4-dimethoxybutane-2,3-diamine (PubChem CID 11051828) has the molecular formula C6H16N2O2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (2S,3S)-1,4-dimethoxybutane-2,3-diamine.
| Compound Name | (2S,3S)-1,4-dimethoxybutane-2,3-diamine |
|---|---|
| PubChem CID | 11051828 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | (2S,3S)-1,4-dimethoxybutane-2,3-diamine |
| SMILES | COC[C@@H](N)[C@H](N)COC |
| InChI | InChI=1S/C6H16N2O2/c1-9-3-5(7)6(8)4-10-2/h5-6H,3-4,7-8H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | FDNVSPLUDUEDAK-PHDIDXHHSA-N |
| XLogP | -1.07 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |