C8H20N2O3 — CID 88989163
1,3,5-trimethoxypentane-2,4-diamine (PubChem CID 88989163) has the molecular formula C8H20N2O3 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,3,5-trimethoxypentane-2,4-diamine.
| Compound Name | 1,3,5-trimethoxypentane-2,4-diamine |
|---|---|
| PubChem CID | 88989163 |
| Molecular Formula | C8H20N2O3 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1,3,5-trimethoxypentane-2,4-diamine |
| SMILES | COCC(N)C(OC)C(N)COC |
| InChI | InChI=1S/C8H20N2O3/c1-11-4-6(9)8(13-3)7(10)5-12-2/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | LMOFIWZWZLTRNB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |