C3H3LiO5 — CID 140653273
lithium 2,3-dihydroxy-3-oxopropanoate (PubChem CID 140653273) has the molecular formula C3H3LiO5 and a molecular weight of 125.99 g/mol. Its IUPAC name is lithium 2,3-dihydroxy-3-oxopropanoate.
| Compound Name | lithium 2,3-dihydroxy-3-oxopropanoate |
|---|---|
| PubChem CID | 140653273 |
| Molecular Formula | C3H3LiO5 |
| Molecular Weight | 125.99 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | lithium 2,3-dihydroxy-3-oxopropanoate |
| SMILES | O=C([O-])C(O)C(=O)O.[Li+] |
| InChI | InChI=1S/C3H4O5.Li/c4-1(2(5)6)3(7)8;/h1,4H,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | LTONBIFZXDREFU-UHFFFAOYSA-M |
| XLogP | -5.81 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.99 |
| LogP ≤ 5 | -5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|