C4H4Ca2O10S — CID 175489646
dicalcium;2,3-dihydroxybutanedioate;sulfate (PubChem CID 175489646) has the molecular formula C4H4Ca2O10S and a molecular weight of 324.29 g/mol. Its IUPAC name is dicalcium;2,3-dihydroxybutanedioate;sulfate.
| Compound Name | dicalcium;2,3-dihydroxybutanedioate;sulfate |
|---|---|
| PubChem CID | 175489646 |
| Molecular Formula | C4H4Ca2O10S |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | dicalcium;2,3-dihydroxybutanedioate;sulfate |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].O=S(=O)([O-])[O-].[Ca+2].[Ca+2] |
| InChI | InChI=1S/C4H6O6.2Ca.H2O4S/c5-1(3(7)8)2(6)4(9)10;;;1-5(2,3)4/h1-2,5-6H,(H,7,8)(H,9,10);;;(H2,1,2,3,4)/q;2*+2;/p-4 |
| InChIKey | OYYQXEYUOJMHQH-UHFFFAOYSA-J |
| XLogP | -6.89 |
| TPSA | 200.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|