C4H4FeO14S2 — CID 172847338
2,3-dihydroxybutanedioate;iron(6+);disulfate (PubChem CID 172847338) has the molecular formula C4H4FeO14S2 and a molecular weight of 396.04 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioate;iron(6+);disulfate.
| Compound Name | 2,3-dihydroxybutanedioate;iron(6+);disulfate |
|---|---|
| PubChem CID | 172847338 |
| Molecular Formula | C4H4FeO14S2 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 395.84 |
| IUPAC Name | 2,3-dihydroxybutanedioate;iron(6+);disulfate |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Fe+6] |
| InChI | InChI=1S/C4H6O6.Fe.2H2O4S/c5-1(3(7)8)2(6)4(9)10;;2*1-5(2,3)4/h1-2,5-6H,(H,7,8)(H,9,10);;2*(H2,1,2,3,4)/q;+6;;/p-6 |
| InChIKey | XPHJAMVNMJPXJT-UHFFFAOYSA-H |
| XLogP | -7.47 |
| TPSA | 281.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | -7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|