C20H20O — CID 87994384
3-benzylidenehepta-1,4,6-trienylbenzene;hydrate (PubChem CID 87994384) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-benzylidenehepta-1,4,6-trienylbenzene;hydrate.
| Compound Name | 3-benzylidenehepta-1,4,6-trienylbenzene;hydrate |
|---|---|
| PubChem CID | 87994384 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-benzylidenehepta-1,4,6-trienylbenzene;hydrate |
| SMILES | C=CC=CC(C=Cc1ccccc1)=Cc1ccccc1.O |
| InChI | InChI=1S/C20H18.H2O/c1-2-3-10-20(17-19-13-8-5-9-14-19)16-15-18-11-6-4-7-12-18;/h2-17H,1H2;1H2 |
| InChIKey | NGQRAXPXIBVKBI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|