C19H19N — CID 87504739
2-ethenylhexa-1,3,5-trienylbenzene;pyridine (PubChem CID 87504739) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-ethenylhexa-1,3,5-trienylbenzene;pyridine.
| Compound Name | 2-ethenylhexa-1,3,5-trienylbenzene;pyridine |
|---|---|
| PubChem CID | 87504739 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-ethenylhexa-1,3,5-trienylbenzene;pyridine |
| SMILES | C=CC=CC(C=C)=Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C14H14.C5H5N/c1-3-5-9-13(4-2)12-14-10-7-6-8-11-14;1-2-4-6-5-3-1/h3-12H,1-2H2;1-5H |
| InChIKey | HWAJVBXCCBBIEA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|