C13H11N — CID 88542343
4-benzylidenehexa-2,5-dienenitrile (PubChem CID 88542343) has the molecular formula C13H11N and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-benzylidenehexa-2,5-dienenitrile.
| Compound Name | 4-benzylidenehexa-2,5-dienenitrile |
|---|---|
| PubChem CID | 88542343 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-benzylidenehexa-2,5-dienenitrile |
| SMILES | C=CC(C=CC#N)=Cc1ccccc1 |
| InChI | InChI=1S/C13H11N/c1-2-12(9-6-10-14)11-13-7-4-3-5-8-13/h2-9,11H,1H2 |
| InChIKey | LYNWUGGMODQDFM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|