About 4-benzylidenehexa-2,5-dienenitrile
4-benzylidenehexa-2,5-dienenitrile (PubChem CID 88542343) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-benzylidenehexa-2,5-dienenitrile.
Molecular Properties
| Compound Name | 4-benzylidenehexa-2,5-dienenitrile |
| PubChem CID | 88542343 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-benzylidenehexa-2,5-dienenitrile |
| SMILES | C=CC(C=CC#N)=Cc1ccccc1 |
| InChI | InChI=1S/C13H11N/c1-2-12(9-6-10-14)11-13-7-4-3-5-8-13/h2-9,11H,1H2 |
| InChIKey | LYNWUGGMODQDFM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylidenehexa-2,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylidenehexa-2,5-dienenitrile?
The IUPAC name of 4-benzylidenehexa-2,5-dienenitrile (CID 88542343) is 4-benzylidenehexa-2,5-dienenitrile.
What is the SMILES notation for 4-benzylidenehexa-2,5-dienenitrile?
The canonical SMILES for 4-benzylidenehexa-2,5-dienenitrile is C=CC(C=CC#N)=Cc1ccccc1.
What is the InChIKey of 4-benzylidenehexa-2,5-dienenitrile?
The InChIKey is LYNWUGGMODQDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-12(9-6-10-14)11-13-7-4-3-5-8-13/h2-9,11H,1H2.
What are the key properties of 4-benzylidenehexa-2,5-dienenitrile?
4-benzylidenehexa-2,5-dienenitrile has a molecular weight of 181.24 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylidenehexa-2,5-dienenitrile is sourced from PubChem (CID 88542343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).