C11H9NS — CID 88761507
5-phenyl-4-sulfanylpenta-2,4-dienenitrile (PubChem CID 88761507) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 5-phenyl-4-sulfanylpenta-2,4-dienenitrile.
| Compound Name | 5-phenyl-4-sulfanylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 88761507 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 5-phenyl-4-sulfanylpenta-2,4-dienenitrile |
| SMILES | N#CC=CC(S)=Cc1ccccc1 |
| InChI | InChI=1S/C11H9NS/c12-8-4-7-11(13)9-10-5-2-1-3-6-10/h1-7,9,13H |
| InChIKey | FEDMNDPLROMTHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|