C19H15Br2N — CID 87583009
4,5-dibromo-5-phenylpenta-2,4-dienenitrile;styrene (PubChem CID 87583009) has the molecular formula C19H15Br2N and a molecular weight of 417.14 g/mol. Its IUPAC name is 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;styrene.
| Compound Name | 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;styrene |
|---|---|
| PubChem CID | 87583009 |
| Molecular Formula | C19H15Br2N |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;styrene |
| SMILES | C=Cc1ccccc1.N#CC=CC(Br)=C(Br)c1ccccc1 |
| InChI | InChI=1S/C11H7Br2N.C8H8/c12-10(7-4-8-14)11(13)9-5-2-1-3-6-9;1-2-8-6-4-3-5-7-8/h1-7H;2-7H,1H2 |
| InChIKey | XHOLZLZGQHOCGT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|