C23H17Br2NO3 — CID 160825170
4,5-dibromo-5-phenylpenta-2,4-dienenitrile;furan-2,5-dione;styrene (PubChem CID 160825170) has the molecular formula C23H17Br2NO3 and a molecular weight of 515.20 g/mol. Its IUPAC name is 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;furan-2,5-dione;styrene.
| Compound Name | 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;furan-2,5-dione;styrene |
|---|---|
| PubChem CID | 160825170 |
| Molecular Formula | C23H17Br2NO3 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | 4,5-dibromo-5-phenylpenta-2,4-dienenitrile;furan-2,5-dione;styrene |
| SMILES | C=Cc1ccccc1.N#CC=CC(Br)=C(Br)c1ccccc1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C11H7Br2N.C8H8.C4H2O3/c12-10(7-4-8-14)11(13)9-5-2-1-3-6-9;1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h1-7H;2-7H,1H2;1-2H |
| InChIKey | SGBGIYJEIKEAHG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|