C10H11N — CID 45079882
3-[(1Z)-2-methylbuta-1,3-dienyl]pyridine (PubChem CID 45079882) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-[(1Z)-2-methylbuta-1,3-dienyl]pyridine.
| Compound Name | 3-[(1Z)-2-methylbuta-1,3-dienyl]pyridine |
|---|---|
| PubChem CID | 45079882 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-[(1Z)-2-methylbuta-1,3-dienyl]pyridine |
| SMILES | C=C/C(C)=C\c1cccnc1 |
| InChI | InChI=1S/C10H11N/c1-3-9(2)7-10-5-4-6-11-8-10/h3-8H,1H2,2H3/b9-7- |
| InChIKey | BLNUCURBRRRVOU-CLFYSBASSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|