C11H13N — CID 143368310
3-[(1Z)-4-methylpenta-1,3-dienyl]pyridine (PubChem CID 143368310) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-[(1Z)-4-methylpenta-1,3-dienyl]pyridine.
| Compound Name | 3-[(1Z)-4-methylpenta-1,3-dienyl]pyridine |
|---|---|
| PubChem CID | 143368310 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-[(1Z)-4-methylpenta-1,3-dienyl]pyridine |
| SMILES | CC(C)=C/C=C\c1cccnc1 |
| InChI | InChI=1S/C11H13N/c1-10(2)5-3-6-11-7-4-8-12-9-11/h3-9H,1-2H3/b6-3- |
| InChIKey | OSJBUQNUDPFNEK-UTCJRWHESA-N |
| XLogP | 3.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|