About 3-(4-phenylbuta-1,3-dienyl)pyridine
3-(4-phenylbuta-1,3-dienyl)pyridine (PubChem CID 71359861) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-(4-phenylbuta-1,3-dienyl)pyridine.
Molecular Properties
| Compound Name | 3-(4-phenylbuta-1,3-dienyl)pyridine |
| PubChem CID | 71359861 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(4-phenylbuta-1,3-dienyl)pyridine |
| SMILES | C(C=Cc1cccnc1)=Cc1ccccc1 |
| InChI | InChI=1S/C15H13N/c1-2-7-14(8-3-1)9-4-5-10-15-11-6-12-16-13-15/h1-13H |
| InChIKey | WCQHKQCBWYWTTF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-phenylbuta-1,3-dienyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenylbuta-1,3-dienyl)pyridine?
The IUPAC name of 3-(4-phenylbuta-1,3-dienyl)pyridine (CID 71359861) is 3-(4-phenylbuta-1,3-dienyl)pyridine.
What is the SMILES notation for 3-(4-phenylbuta-1,3-dienyl)pyridine?
The canonical SMILES for 3-(4-phenylbuta-1,3-dienyl)pyridine is C(C=Cc1cccnc1)=Cc1ccccc1.
What is the InChIKey of 3-(4-phenylbuta-1,3-dienyl)pyridine?
The InChIKey is WCQHKQCBWYWTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-2-7-14(8-3-1)9-4-5-10-15-11-6-12-16-13-15/h1-13H.
What are the key properties of 3-(4-phenylbuta-1,3-dienyl)pyridine?
3-(4-phenylbuta-1,3-dienyl)pyridine has a molecular weight of 207.28 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenylbuta-1,3-dienyl)pyridine is sourced from PubChem (CID 71359861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).