C32H24N6 — CID 19937846
2,3,5,6-tetrakis[(E)-2-pyridin-3-ylethenyl]pyrazine (PubChem CID 19937846) has the molecular formula C32H24N6 and a molecular weight of 492.59 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[(E)-2-pyridin-3-ylethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[(E)-2-pyridin-3-ylethenyl]pyrazine |
|---|---|
| PubChem CID | 19937846 |
| Molecular Formula | C32H24N6 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 2,3,5,6-tetrakis[(E)-2-pyridin-3-ylethenyl]pyrazine |
| SMILES | C(=C/c1nc(/C=C/c2cccnc2)c(/C=C/c2cccnc2)nc1/C=C/c1cccnc1)\c1cccnc1 |
| InChI | InChI=1S/C32H24N6/c1-5-25(21-33-17-1)9-13-29-30(14-10-26-6-2-18-34-22-26)38-32(16-12-28-8-4-20-36-24-28)31(37-29)15-11-27-7-3-19-35-23-27/h1-24H/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | KMFXYZOVYGGQQK-KUWVSJDVSA-N |
| XLogP | 6.74 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |