4-benzylideneocta-2,5,7-trienoic acid

C15H14O2 — CID 54332151

IUPAC4-benzylideneocta-2,5,7-trienoic acid
SMILESC=CC=CC(C=CC(=O)O)=Cc1ccccc1
InChIInChI=1S/C15H14O2/c1-2-3-7-14(10-11-15(16)17)12-13-8-5-4-6-9-13/h2-12H,1H2,(H,16,17)
InChIKeySZCFKVYXDZMNTO-UHFFFAOYSA-N
MW226.27 g/mol
LogP3.45
Rot. Bonds5

About 4-benzylideneocta-2,5,7-trienoic acid

4-benzylideneocta-2,5,7-trienoic acid (PubChem CID 54332151) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-benzylideneocta-2,5,7-trienoic acid.

Molecular Properties

Compound Name4-benzylideneocta-2,5,7-trienoic acid
PubChem CID54332151
Molecular FormulaC15H14O2
Molecular Weight226.27 g/mol
Exact Mass226.10
IUPAC Name4-benzylideneocta-2,5,7-trienoic acid
SMILESC=CC=CC(C=CC(=O)O)=Cc1ccccc1
InChIInChI=1S/C15H14O2/c1-2-3-7-14(10-11-15(16)17)12-13-8-5-4-6-9-13/h2-12H,1H2,(H,16,17)
InChIKeySZCFKVYXDZMNTO-UHFFFAOYSA-N
XLogP3.45
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.27
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 4-benzylideneocta-2,5,7-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-benzylideneocta-2,5,7-trienoic acid?
The IUPAC name of 4-benzylideneocta-2,5,7-trienoic acid (CID 54332151) is 4-benzylideneocta-2,5,7-trienoic acid.
What is the SMILES notation for 4-benzylideneocta-2,5,7-trienoic acid?
The canonical SMILES for 4-benzylideneocta-2,5,7-trienoic acid is C=CC=CC(C=CC(=O)O)=Cc1ccccc1.
What is the InChIKey of 4-benzylideneocta-2,5,7-trienoic acid?
The InChIKey is SZCFKVYXDZMNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c1-2-3-7-14(10-11-15(16)17)12-13-8-5-4-6-9-13/h2-12H,1H2,(H,16,17).
What are the key properties of 4-benzylideneocta-2,5,7-trienoic acid?
4-benzylideneocta-2,5,7-trienoic acid has a molecular weight of 226.27 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylideneocta-2,5,7-trienoic acid is sourced from PubChem (CID 54332151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).