C17H15N — CID 54095007
2-ethenyl-3-(2-phenylethenyl)hepta-2,4,6-trienenitrile (PubChem CID 54095007) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-ethenyl-3-(2-phenylethenyl)hepta-2,4,6-trienenitrile.
| Compound Name | 2-ethenyl-3-(2-phenylethenyl)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 54095007 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-ethenyl-3-(2-phenylethenyl)hepta-2,4,6-trienenitrile |
| SMILES | C=CC=CC(C=Cc1ccccc1)=C(C#N)C=C |
| InChI | InChI=1S/C17H15N/c1-3-5-11-17(16(4-2)14-18)13-12-15-9-7-6-8-10-15/h3-13H,1-2H2 |
| InChIKey | MWMYWZNHRAKITD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|