About N-phenylprop-2-enimidoyl chloride
N-phenylprop-2-enimidoyl chloride (PubChem CID 15040268) has the molecular formula C9H8ClN
and a molecular weight of 165.62 g/mol. Its IUPAC name is N-phenylprop-2-enimidoyl chloride.
Molecular Properties
| Compound Name | N-phenylprop-2-enimidoyl chloride |
| PubChem CID | 15040268 |
| Molecular Formula | C9H8ClN |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | N-phenylprop-2-enimidoyl chloride |
| SMILES | C=C/C(Cl)=N/c1ccccc1 |
| InChI | InChI=1S/C9H8ClN/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2/b11-9- |
| InChIKey | YFAJZYGEOGNKDT-LUAWRHEFSA-N |
| XLogP | 3.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenylprop-2-enimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylprop-2-enimidoyl chloride?
The IUPAC name of N-phenylprop-2-enimidoyl chloride (CID 15040268) is N-phenylprop-2-enimidoyl chloride.
What is the SMILES notation for N-phenylprop-2-enimidoyl chloride?
The canonical SMILES for N-phenylprop-2-enimidoyl chloride is C=C/C(Cl)=N/c1ccccc1.
What is the InChIKey of N-phenylprop-2-enimidoyl chloride?
The InChIKey is YFAJZYGEOGNKDT-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H8ClN/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2/b11-9-.
What are the key properties of N-phenylprop-2-enimidoyl chloride?
N-phenylprop-2-enimidoyl chloride has a molecular weight of 165.62 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylprop-2-enimidoyl chloride is sourced from PubChem (CID 15040268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).