About 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride
2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride (PubChem CID 3302476) has the molecular formula C15H10Cl4N2
and a molecular weight of 360.07 g/mol. Its IUPAC name is 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride.
Molecular Properties
| Compound Name | 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride |
| PubChem CID | 3302476 |
| Molecular Formula | C15H10Cl4N2 |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride |
| SMILES | Cl/C(=N\c1ccccc1)C(Cl)(Cl)/C(Cl)=N/c1ccccc1 |
| InChI | InChI=1S/C15H10Cl4N2/c16-13(20-11-7-3-1-4-8-11)15(18,19)14(17)21-12-9-5-2-6-10-12/h1-10H/b20-13-,21-14- |
| InChIKey | IOQLAUGPKPJPDF-NMGXZBPKSA-N |
| XLogP | 6.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride?
The IUPAC name of 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride (CID 3302476) is 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride.
What is the SMILES notation for 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride?
The canonical SMILES for 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride is Cl/C(=N\c1ccccc1)C(Cl)(Cl)/C(Cl)=N/c1ccccc1.
What is the InChIKey of 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride?
The InChIKey is IOQLAUGPKPJPDF-NMGXZBPKSA-N. The full InChI is InChI=1S/C15H10Cl4N2/c16-13(20-11-7-3-1-4-8-11)15(18,19)14(17)21-12-9-5-2-6-10-12/h1-10H/b20-13-,21-14-.
What are the key properties of 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride?
2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride has a molecular weight of 360.07 g/mol, XLogP of 6.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride is sourced from PubChem (CID 3302476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).