C15H10Cl4N2 — CID 3302476
2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride (PubChem CID 3302476) has the molecular formula C15H10Cl4N2 and a molecular weight of 360.07 g/mol. Its IUPAC name is 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride.
| Compound Name | 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride |
|---|---|
| PubChem CID | 3302476 |
| Molecular Formula | C15H10Cl4N2 |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2,2-dichloro-N,N'-diphenylpropanediimidoyl dichloride |
| SMILES | Cl/C(=N\c1ccccc1)C(Cl)(Cl)/C(Cl)=N/c1ccccc1 |
| InChI | InChI=1S/C15H10Cl4N2/c16-13(20-11-7-3-1-4-8-11)15(18,19)14(17)21-12-9-5-2-6-10-12/h1-10H/b20-13-,21-14- |
| InChIKey | IOQLAUGPKPJPDF-NMGXZBPKSA-N |
| XLogP | 6.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|