C16H10ClF2N — CID 132933309
1-chloro-1,1-difluoro-N,4-diphenylbut-3-yn-2-imine (PubChem CID 132933309) has the molecular formula C16H10ClF2N and a molecular weight of 289.71 g/mol. Its IUPAC name is 1-chloro-1,1-difluoro-N,4-diphenylbut-3-yn-2-imine.
| Compound Name | 1-chloro-1,1-difluoro-N,4-diphenylbut-3-yn-2-imine |
|---|---|
| PubChem CID | 132933309 |
| Molecular Formula | C16H10ClF2N |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-chloro-1,1-difluoro-N,4-diphenylbut-3-yn-2-imine |
| SMILES | FC(F)(Cl)/C(C#Cc1ccccc1)=N/c1ccccc1 |
| InChI | InChI=1S/C16H10ClF2N/c17-16(18,19)15(20-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H/b20-15+ |
| InChIKey | BFZKOPIWEUMFSA-HMMYKYKNSA-N |
| XLogP | 4.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|