C17H12F3N — CID 24978072
1,1,1-trifluoro-N-(4-methylphenyl)-4-phenylbut-3-yn-2-imine (PubChem CID 24978072) has the molecular formula C17H12F3N and a molecular weight of 287.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-methylphenyl)-4-phenylbut-3-yn-2-imine.
| Compound Name | 1,1,1-trifluoro-N-(4-methylphenyl)-4-phenylbut-3-yn-2-imine |
|---|---|
| PubChem CID | 24978072 |
| Molecular Formula | C17H12F3N |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-methylphenyl)-4-phenylbut-3-yn-2-imine |
| SMILES | Cc1ccc(/N=C(\C#Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F3N/c1-13-7-10-15(11-8-13)21-16(17(18,19)20)12-9-14-5-3-2-4-6-14/h2-8,10-11H,1H3/b21-16+ |
| InChIKey | IMAFNSZVJCREKM-LTGZKZEYSA-N |
| XLogP | 4.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|