C12H11F3N2 — CID 166438280
N,N-dimethyl-4-(1,1,1-trifluorobut-3-yn-2-ylideneamino)aniline (PubChem CID 166438280) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,1,1-trifluorobut-3-yn-2-ylideneamino)aniline.
| Compound Name | N,N-dimethyl-4-(1,1,1-trifluorobut-3-yn-2-ylideneamino)aniline |
|---|---|
| PubChem CID | 166438280 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N,N-dimethyl-4-(1,1,1-trifluorobut-3-yn-2-ylideneamino)aniline |
| SMILES | C#C/C(=N\c1ccc(N(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2/c1-4-11(12(13,14)15)16-9-5-7-10(8-6-9)17(2)3/h1,5-8H,2-3H3/b16-11+ |
| InChIKey | CVCVKKWJZXEGKO-LFIBNONCSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|