C19H17N — CID 15182209
1-cyclopenta-2,4-dien-1-yl-N-(4-methylphenyl)-1-phenylmethanimine (PubChem CID 15182209) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-N-(4-methylphenyl)-1-phenylmethanimine.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-N-(4-methylphenyl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 15182209 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-N-(4-methylphenyl)-1-phenylmethanimine |
| SMILES | Cc1ccc(/N=C(\c2ccccc2)C2C=CC=C2)cc1 |
| InChI | InChI=1S/C19H17N/c1-15-11-13-18(14-12-15)20-19(17-9-5-6-10-17)16-7-3-2-4-8-16/h2-14,17H,1H3/b20-19+ |
| InChIKey | CRSGHAIORJBKRR-FMQUCBEESA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|