C26H22HgN2 — CID 6915725
(C,N-diphenylcarbonimidoyl)-(4-methylphenyl)azanide;phenylmercury(1+) (PubChem CID 6915725) has the molecular formula C26H22HgN2 and a molecular weight of 563.07 g/mol. Its IUPAC name is (C,N-diphenylcarbonimidoyl)-(4-methylphenyl)azanide;phenylmercury(1+).
| Compound Name | (C,N-diphenylcarbonimidoyl)-(4-methylphenyl)azanide;phenylmercury(1+) |
|---|---|
| PubChem CID | 6915725 |
| Molecular Formula | C26H22HgN2 |
| Molecular Weight | 563.07 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | (C,N-diphenylcarbonimidoyl)-(4-methylphenyl)azanide;phenylmercury(1+) |
| SMILES | Cc1ccc([N-]/C(=N/c2ccccc2)c2ccccc2)cc1.[Hg+]c1ccccc1 |
| InChI | InChI=1S/C20H17N2.C6H5.Hg/c1-16-12-14-19(15-13-16)22-20(17-8-4-2-5-9-17)21-18-10-6-3-7-11-18;1-2-4-6-5-3-1;/h2-15H,1H3;1-5H;/q-1;;+1 |
| InChIKey | FPISMYPJLRXDKF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|