C19H24NP — CID 122373224
1-di(propan-2-yl)phosphanyl-N,1-diphenylmethanimine (PubChem CID 122373224) has the molecular formula C19H24NP and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-di(propan-2-yl)phosphanyl-N,1-diphenylmethanimine.
| Compound Name | 1-di(propan-2-yl)phosphanyl-N,1-diphenylmethanimine |
|---|---|
| PubChem CID | 122373224 |
| Molecular Formula | C19H24NP |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-di(propan-2-yl)phosphanyl-N,1-diphenylmethanimine |
| SMILES | CC(C)P(/C(=N/c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C19H24NP/c1-15(2)21(16(3)4)19(17-11-7-5-8-12-17)20-18-13-9-6-10-14-18/h5-16H,1-4H3/b20-19+ |
| InChIKey | MYLGSVHUAUZZFE-FMQUCBEESA-N |
| XLogP | 6.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|