C12H15Cl2N — CID 15621082
1,1-dichloro-4-methyl-N-phenylpentan-2-imine (PubChem CID 15621082) has the molecular formula C12H15Cl2N and a molecular weight of 244.17 g/mol. Its IUPAC name is 1,1-dichloro-4-methyl-N-phenylpentan-2-imine.
| Compound Name | 1,1-dichloro-4-methyl-N-phenylpentan-2-imine |
|---|---|
| PubChem CID | 15621082 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1,1-dichloro-4-methyl-N-phenylpentan-2-imine |
| SMILES | CC(C)C/C(=N\c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C12H15Cl2N/c1-9(2)8-11(12(13)14)15-10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3/b15-11+ |
| InChIKey | CIRILEJKSSYCRA-RVDMUPIBSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|