C20H26N6 — CID 159784015
3-[[(2R)-3-amino-2-methyl-3-phenyliminopropyl]diazenyl]-2-methyl-N'-phenylpropanimidamide (PubChem CID 159784015) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-[[(2R)-3-amino-2-methyl-3-phenyliminopropyl]diazenyl]-2-methyl-N'-phenylpropanimidamide.
| Compound Name | 3-[[(2R)-3-amino-2-methyl-3-phenyliminopropyl]diazenyl]-2-methyl-N'-phenylpropanimidamide |
|---|---|
| PubChem CID | 159784015 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-[[(2R)-3-amino-2-methyl-3-phenyliminopropyl]diazenyl]-2-methyl-N'-phenylpropanimidamide |
| SMILES | CC(C/N=N/C[C@@H](C)/C(N)=N/c1ccccc1)/C(N)=N/c1ccccc1 |
| InChI | InChI=1S/C20H26N6/c1-15(19(21)25-17-9-5-3-6-10-17)13-23-24-14-16(2)20(22)26-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H2,21,25)(H2,22,26)/b24-23+/t15-,16?/m1/s1 |
| InChIKey | NLSMPUXDZWRNOV-VQMPSXAKSA-N |
| XLogP | 4.09 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|