C16H17N5 — CID 123822499
2-methanimidoyl-1-N',3-N'-diphenylpropanediimidamide (PubChem CID 123822499) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-methanimidoyl-1-N',3-N'-diphenylpropanediimidamide.
| Compound Name | 2-methanimidoyl-1-N',3-N'-diphenylpropanediimidamide |
|---|---|
| PubChem CID | 123822499 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-methanimidoyl-1-N',3-N'-diphenylpropanediimidamide |
| SMILES | [H]/N=C/C(/C(N)=N/c1ccccc1)/C(N)=N/c1ccccc1 |
| InChI | InChI=1S/C16H17N5/c17-11-14(15(18)20-12-7-3-1-4-8-12)16(19)21-13-9-5-2-6-10-13/h1-11,14,17H,(H2,18,20)(H2,19,21)/b17-11+ |
| InChIKey | VSMFEBIPWKIXCT-GZTJUZNOSA-N |
| XLogP | 2.63 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|