C24H24N9S3+3 — CID 135587733
[4,6-bis[(N'-phenylcarbamimidoyl)sulfanyl]-1,3,5-triazine-1,3,5-triium-2-yl] N'-phenylcarbamimidothioate (PubChem CID 135587733) has the molecular formula C24H24N9S3+3 and a molecular weight of 534.72 g/mol. Its IUPAC name is [4,6-bis[(N'-phenylcarbamimidoyl)sulfanyl]-1,3,5-triazine-1,3,5-triium-2-yl] N'-phenylcarbamimidothioate.
| Compound Name | [4,6-bis[(N'-phenylcarbamimidoyl)sulfanyl]-1,3,5-triazine-1,3,5-triium-2-yl] N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 135587733 |
| Molecular Formula | C24H24N9S3+3 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | [4,6-bis[(N'-phenylcarbamimidoyl)sulfanyl]-1,3,5-triazine-1,3,5-triium-2-yl] N'-phenylcarbamimidothioate |
| SMILES | N/C(=N\c1ccccc1)Sc1[nH+]c(S/C(N)=N/c2ccccc2)[nH+]c(S/C(N)=N/c2ccccc2)[nH+]1 |
| InChI | InChI=1S/C24H21N9S3/c25-19(28-16-10-4-1-5-11-16)34-22-31-23(35-20(26)29-17-12-6-2-7-13-17)33-24(32-22)36-21(27)30-18-14-8-3-9-15-18/h1-15H,(H2,25,28)(H2,26,29)(H2,27,30)/p+3 |
| InChIKey | UPOHXIDMRUQPHY-UHFFFAOYSA-Q |
| XLogP | 3.34 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|