C18H23BrN4S2 — CID 54605449
4-(N'-phenylcarbamimidoyl)sulfanylbutyl N'-phenylcarbamimidothioate;hydrobromide (PubChem CID 54605449) has the molecular formula C18H23BrN4S2 and a molecular weight of 439.45 g/mol. Its IUPAC name is 4-(N'-phenylcarbamimidoyl)sulfanylbutyl N'-phenylcarbamimidothioate;hydrobromide.
| Compound Name | 4-(N'-phenylcarbamimidoyl)sulfanylbutyl N'-phenylcarbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 54605449 |
| Molecular Formula | C18H23BrN4S2 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 4-(N'-phenylcarbamimidoyl)sulfanylbutyl N'-phenylcarbamimidothioate;hydrobromide |
| SMILES | Br.N/C(=N/c1ccccc1)SCCCCS/C(N)=N/c1ccccc1 |
| InChI | InChI=1S/C18H22N4S2.BrH/c19-17(21-15-9-3-1-4-10-15)23-13-7-8-14-24-18(20)22-16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2,(H2,19,21)(H2,20,22);1H |
| InChIKey | NIOGRSPGNUFKBM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|